2-(cyclohexylthio)-5-nitrobenzaldehyde
Modify Date: 2026-02-12 09:52:29
2-(cyclohexylthio)-5-nitrobenzaldehyde structure
|
Common Name | 2-(cyclohexylthio)-5-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 175278-46-3 | Molecular Weight | 265.32800 | |
| Density | 1.26g/cm3 | Boiling Point | 416.2ºC at 760mmHg | |
| Molecular Formula | C13H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | 2-cyclohexylsulfanyl-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 416.2ºC at 760mmHg |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.32800 |
| Flash Point | 205.5ºC |
| Exact Mass | 265.07700 |
| PSA | 88.19000 |
| LogP | 4.35530 |
| Vapour Pressure | 3.89E-07mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | KKPVOEAECFNQNB-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1SC1CCCCC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2930909090 |
|
~%
2-(cyclohexylth... CAS#:175278-46-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 5, # 12 p. 2203 - 2211 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(Cyclohexylthio)-5-nitrobenzaldehyde |
| MFCD00084990 |
| 2-(cyclohexylsulfanyl)-5-nitrobenzaldehyde |