1,4-difluorofluoren-9-one structure
|
Common Name | 1,4-difluorofluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 17532-94-4 | Molecular Weight | 216.18300 | |
| Density | 1.41g/cm3 | Boiling Point | 352.1ºC at 760 mmHg | |
| Molecular Formula | C13H6F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.8ºC | |
| Name | 1,4-difluorofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 352.1ºC at 760 mmHg |
| Molecular Formula | C13H6F2O |
| Molecular Weight | 216.18300 |
| Flash Point | 134.8ºC |
| Exact Mass | 216.03900 |
| PSA | 17.07000 |
| LogP | 3.17620 |
| Vapour Pressure | 3.92E-05mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | OVPZENZRSOPWMR-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2-c2c(F)ccc(F)c21 |
|
~%
1,4-difluoroflu... CAS#:17532-94-4 |
| Literature: Namkung,M.J.; Fletcher,T.L. Canadian Journal of Chemistry, 1967 , vol. 45, p. 2569 - 2575 |
|
~%
1,4-difluoroflu... CAS#:17532-94-4 |
| Literature: Namkung,M.J.; Fletcher,T.L. Canadian Journal of Chemistry, 1967 , vol. 45, p. 2569 - 2575 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| 1,4-Difluor-9-oxo-fluoren |
| 1,4-difluoro-9-fluorenone |
| 1,4-difluoro-9h-fluoren-9-one |