1,2,4,7-tetrafluorofluoren-9-one
1,2,4,7-tetrafluorofluoren-9-one structure
|
Common Name | 1,2,4,7-tetrafluorofluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 17533-02-7 | Molecular Weight | 252.16400 | |
| Density | 1.559g/cm3 | Boiling Point | 370ºC at 760 mmHg | |
| Molecular Formula | C13H4F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,4,7-tetrafluorofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 370ºC at 760 mmHg |
| Molecular Formula | C13H4F4O |
| Molecular Weight | 252.16400 |
| Flash Point | 141.4ºC |
| Exact Mass | 252.02000 |
| PSA | 17.07000 |
| LogP | 3.45440 |
| Vapour Pressure | 1.14E-05mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | YZHJGLANVCTVRF-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(F)ccc2-c2c(F)cc(F)c(F)c21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:17533-08-3
CAS#:6942-39-8
CAS#:2265-92-1
CAS#:17532-94-4
CAS#:17526-11-3
CAS#:17532-95-5
CAS#:17698-83-8
CAS#:17532-99-9
CAS#:2969-66-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,4,7-Tetrafluor-fluoren-9-on |
| 1,2,4,7-tetrafluoro-9h-fluoren-9-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: Polar surface area (PSA) of 1,2,4,7-tetrafluorofluoren-9-one is 17.07000. |
| Q: What is the boiling point of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: Boiling point of 1,2,4,7-tetrafluorofluoren-9-one is 370ºC at 760 mmHg. |
| Q: What is the Chinese name of 17533-02-7? |
| A: Chinese name of 17533-02-7 is 17533-02-7. |
| Q: What is the LogP of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: LogP of 1,2,4,7-tetrafluorofluoren-9-one is 3.45440. |
| Q: What is the InChIKey of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: InChIKey of 1,2,4,7-tetrafluorofluoren-9-one is YZHJGLANVCTVRF-UHFFFAOYSA-N. |
| Q: What is the English name of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: The English name of 1,2,4,7-tetrafluorofluoren-9-one is 1,2,4,7-tetrafluorofluoren-9-one. |
| Q: What is the CAS number of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: CAS number of 1,2,4,7-tetrafluorofluoren-9-one is 17533-02-7. |
| Q: What is the molecular formula of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: Molecular formula of 1,2,4,7-tetrafluorofluoren-9-one is C13H4F4O. |
| Q: What is the SMILES notation of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: SMILES notation of 1,2,4,7-tetrafluorofluoren-9-one is O=C1c2cc(F)ccc2-c2c(F)cc(F)c(F)c21. |
| Q: What are the upstream materials of 1,2,4,7-tetrafluorofluoren-9-one? |
| A: Related upstream materials(CAS) of 1,2,4,7-tetrafluorofluoren-9-one: 17533-08-3;6942-39-8;2265-92-1;17532-94-4;17526-11-3;17532-95-5;17698-83-8;17532-99-9;2969-66-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |