4-sec-Butyl-2,6-di-tert-butylphenol structure
|
Common Name | 4-sec-Butyl-2,6-di-tert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 17540-75-9 | Molecular Weight | 262.43000 | |
| Density | 0.902 g/mL at 25ºC(lit.) | Boiling Point | 141-142ºC10 mm Hg(lit.) | |
| Molecular Formula | C18H30O | Melting Point | 25ºC(lit.) | |
| MSDS | USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,6-Di-tert-butyl-4-sec-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.902 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 141-142ºC10 mm Hg(lit.) |
| Melting Point | 25ºC(lit.) |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.43000 |
| Flash Point | >230 °F |
| Exact Mass | 262.23000 |
| PSA | 20.23000 |
| LogP | 5.50070 |
| Vapour Pressure | 0.0035mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | BFZOTKYPSZSDEV-UHFFFAOYSA-N |
| SMILES | CCC(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2907199090 |
|
~%
4-sec-Butyl-2,6... CAS#:17540-75-9 |
| Literature: Journal of the American Chemical Society, , vol. 71, p. 4110 |
|
~%
4-sec-Butyl-2,6... CAS#:17540-75-9 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 1176,1178 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Synthesis of 4-(Sec-butyl)-2, 6-di-tert-butylphenol. ZANG Y-L, et al.
Fine Chemicals 1 , 018, (2012)
|
| EINECS 241-533-0 |
| MFCD00075575 |
| 4-sec-Butyl-2,6-di-tert-butylphenol |
| 4-butan-2-yl-2,6-ditert-butylphenol |