Fmoc-Phe(4-Cl)-OH
Fmoc-Phe(4-Cl)-OH structure
|
Common Name | Fmoc-Phe(4-Cl)-OH | ||
|---|---|---|---|---|
| CAS Number | 175453-08-4 | Molecular Weight | 421.873 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 640.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H20ClNO4 | Melting Point | 138ºC | |
| MSDS | Chinese USA | Flash Point | 341.4±31.5 °C | |
Use of Fmoc-Phe(4-Cl)-OHFmoc-Phe(4-Cl)-OH is a phenylalanine derivative[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Fmoc-Phe(4-Cl)-OH is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 640.9±55.0 °C at 760 mmHg |
| Melting Point | 138ºC |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.873 |
| Flash Point | 341.4±31.5 °C |
| Exact Mass | 421.108093 |
| PSA | 75.63000 |
| LogP | 6.00 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | CQPNKLNINBUUOM-QFIPXVFZSA-N |
| SMILES | O=C(NC(Cc1ccc(Cl)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine |
| Fmoc-4-chloro-D-phenylalanine |
| MFCD00080281 |
| Fmoc-Phe(4-Cl)-OH |
| (2R)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| (S)-N-Fmoc-4-Chlorophenylalanine |
| Fmoc-L-4-Chlorophenylalanine |
| Fmoc-4-Chloro-Phe-OH |
| (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-chlorophenyl)propanoic acid |
| Fmoc-4-chloro-L-phenylalanine |
| (2S)-3-(4-chlorophenyl)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-chlorophenyl)propanoic acid |
| AmbotzFAA1418 |
| Fmoc-D-Phe(4-Cl)-OH |
| FMOC-PCL-L-PHE-OH |
| Fmoc-L-phe(4-Cl)-OH |
| Fmoc-4-chloro-Phenylalanine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: CAS number of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is 175453-08-4. |
| Q: What is the English name of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: The English name of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. |
| Q: What is the safety information for (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: Safety information for (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid: S24/25. |
| Q: What is the InChIKey of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: InChIKey of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is CQPNKLNINBUUOM-QFIPXVFZSA-N. |
| Q: What are the uses of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: Main uses of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid: Fmoc-Phe(4-Cl)-OH is a phenylalanine derivative[1]. |
| Q: What is the molecular formula of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: Molecular formula of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is C24H20ClNO4. |
| Q: What is the molecular weight of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: Molecular weight of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is 421.873. |
| Q: What is the SMILES notation of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: SMILES notation of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is O=C(NC(Cc1ccc(Cl)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the polar surface area (PSA) of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: Polar surface area (PSA) of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is 75.63000. |
| Q: What is the LogP of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid? |
| A: LogP of (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid is 6.00. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |