Lead(2+) dimethanesulfonate
Lead(2+) dimethanesulfonate structure
|
Common Name | Lead(2+) dimethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 17570-76-2 | Molecular Weight | 397.39500 | |
| Density | 1,7 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C2H6O6PbS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Plumbous methanesulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1,7 g/cm3 |
|---|---|
| Molecular Formula | C2H6O6PbS2 |
| Molecular Weight | 397.39500 |
| Exact Mass | 397.93700 |
| PSA | 131.16000 |
| LogP | 0.10360 |
| Index of Refraction | 1.4230 |
| InChIKey | LLABTCPIBSAMGS-UHFFFAOYSA-L |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Pb+2] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | T:Toxic;N:Dangerousfortheenvironment; |
|---|---|
| Risk Phrases | R20/22;R33;R38;R41;R48/20/22;R58 |
| Safety Phrases | S45-S53-S57-S61 |
| RIDADR | UN 3265 8/PG 2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00137736 |
| Lead(II) methanesulfonate |
| Lead(2+) dimethanesulfonate |
| EINECS 401-750-5 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of Plumbous methanesulfonate? |
| A: Polar surface area (PSA) of Plumbous methanesulfonate is 131.16000. |
| Q: What is the molecular formula of Plumbous methanesulfonate? |
| A: Molecular formula of Plumbous methanesulfonate is C2H6O6PbS2. |
| Q: What is the CAS number of Plumbous methanesulfonate? |
| A: CAS number of Plumbous methanesulfonate is 17570-76-2. |
| Q: What is the English name of Plumbous methanesulfonate? |
| A: The English name of Plumbous methanesulfonate is Plumbous methanesulfonate. |
| Q: What English synonyms does Plumbous methanesulfonate have? |
| A: English synonyms of Plumbous methanesulfonate: MFCD00137736, Lead(II) methanesulfonate, Lead(2+) dimethanesulfonate, EINECS 401-750-5. |
| Q: What is the SMILES notation of Plumbous methanesulfonate? |
| A: SMILES notation of Plumbous methanesulfonate is CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Pb+2]. |
| Q: What is the safety information for Plumbous methanesulfonate? |
| A: Safety information for Plumbous methanesulfonate: S45-S53-S57-S61. |
| Q: What is the LogP of Plumbous methanesulfonate? |
| A: LogP of Plumbous methanesulfonate is 0.10360. |
| Q: What is the InChIKey of Plumbous methanesulfonate? |
| A: InChIKey of Plumbous methanesulfonate is LLABTCPIBSAMGS-UHFFFAOYSA-L. |
| Q: What is the molecular weight of Plumbous methanesulfonate? |
| A: Molecular weight of Plumbous methanesulfonate is 397.39500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |