4,4'-(Hexafluoroisopropylidene)diphthalic acid structure
|
Common Name | 4,4'-(Hexafluoroisopropylidene)diphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 3016-76-0 | Molecular Weight | 480.26800 | |
| Density | 1.681 g/cm3 | Boiling Point | 572.3ºC at 760 mmHg | |
| Molecular Formula | C19H10F6O8 | Melting Point | 240-241ºC | |
| MSDS | N/A | Flash Point | 299.9ºC | |
| Name | 4-[2-(3,4-dicarboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.681 g/cm3 |
|---|---|
| Boiling Point | 572.3ºC at 760 mmHg |
| Melting Point | 240-241ºC |
| Molecular Formula | C19H10F6O8 |
| Molecular Weight | 480.26800 |
| Flash Point | 299.9ºC |
| Exact Mass | 480.02800 |
| PSA | 149.20000 |
| LogP | 3.89010 |
| Index of Refraction | 1.565 |
| InChIKey | APXJLYIVOFARRM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(c2ccc(C(=O)O)c(C(=O)O)c2)(C(F)(F)F)C(F)(F)F)cc1C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39-36 |
| HS Code | 2917399090 |
|
~%
4,4'-(Hexafluor... CAS#:3016-76-0 |
| Literature: Journal of Fluorine Chemistry, , vol. 123, # 2 p. 221 - 225 |
|
~%
4,4'-(Hexafluor... CAS#:3016-76-0 |
| Literature: Journal of Fluorine Chemistry, , vol. 123, # 2 p. 221 - 225 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4'-(Perfluoropropane-2,2-diyl)diphthalic acid |
| EINECS 221-154-7 |