1,6-diaminoanthracene-9,10-dione structure
|
Common Name | 1,6-diaminoanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 1758-64-1 | Molecular Weight | 238.24100 | |
| Density | 1.456g/cm3 | Boiling Point | 551.9ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.6ºC | |
| Name | 1,6-diaminoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 551.9ºC at 760 mmHg |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.24100 |
| Flash Point | 287.6ºC |
| Exact Mass | 238.07400 |
| PSA | 86.18000 |
| LogP | 2.78880 |
| Vapour Pressure | 3.17E-12mmHg at 25°C |
| Index of Refraction | 1.757 |
| InChIKey | UDBLWRCGYSQDGK-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)c1cccc(N)c1C2=O |
| HS Code | 2922399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,6-diamino-9,10-anthracenedione |
| 9,1,6-diamino |
| 2,6-diaminoanthraquinone |
| 1,6-DIAMINOANTHRAQUINONE |
| 1,6-Diamino-9,10-anthraquinone |
| Anthraquinone,1,6-diamino |
| 1,6-Diamino-anthrachinon |