1,7-diaminoanthracene-9,10-dione structure
|
Common Name | 1,7-diaminoanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 3927-72-8 | Molecular Weight | 238.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,7-diaminoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10N2O2 |
|---|---|
| Molecular Weight | 238.24100 |
| Exact Mass | 238.07400 |
| PSA | 86.18000 |
| LogP | 2.78880 |
| InChIKey | YNGOIPAYCAIZAS-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)c1c(N)cccc1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,7-Diamino-9,10-anthraquinone |
| 1,7-diaminoanthraquinone |
| 9,10-Anthracenedione,1,7-diamino |
| 1,7-diamino-9,10-anthracenedione |
| 1,7-Diamino-anthrachinon |