Benzenesulfonic acid,4,4'-(1-triazene-1,3-diyl)bis- (9CI)
Modify Date: 2026-07-07 20:43:22
Benzenesulfonic acid,4,4'-(1-triazene-1,3-diyl)bis- (9CI) structure
|
Common Name | Benzenesulfonic acid,4,4'-(1-triazene-1,3-diyl)bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 17596-06-4 | Molecular Weight | 357.36200 | |
| Density | 1.63g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4'-(triaz-1-ene-1,3-diyl)dibenzenesulfonic acid |
|---|
| Density | 1.63g/cm3 |
|---|---|
| Molecular Formula | C12H11N3O6S2 |
| Molecular Weight | 357.36200 |
| Exact Mass | 357.00900 |
| PSA | 162.25000 |
| LogP | 4.52540 |
| Index of Refraction | 1.687 |
| InChIKey | AJMWXYSMAMYAIT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(N=NNc2ccc(S(=O)(=O)O)cc2)cc1 |
|
Name: Inhibition of human recombinant C-terminal FLAG-tagged autotaxin expressed in baculov...
Source: ChEMBL
Target: Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
External Id: CHEMBL1115235
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 3, Current Page 1 of 1
1