Triazene, 1,3-di-p-tolyl structure
|
Common Name | Triazene, 1,3-di-p-tolyl | ||
|---|---|---|---|---|
| CAS Number | 785-86-4 | Molecular Weight | 225.28900 | |
| Density | 1.05g/cm3 | Boiling Point | 344.5ºC at 760 mmHg | |
| Molecular Formula | C14H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.2ºC | |
| Name | 4-methyl-N-[(4-methylphenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 344.5ºC at 760 mmHg |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.28900 |
| Flash Point | 162.2ºC |
| Exact Mass | 225.12700 |
| PSA | 36.75000 |
| LogP | 4.48720 |
| Index of Refraction | 1.577 |
| InChIKey | XHAYNCDFLBEADB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=NNc2ccc(C)cc2)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1.3-Bis-p-tolyltriazene |
| 1,3-di(4'-methylphenyl)triazene |
| Triazene,3-di-p-tolyl |
| 1,3-di-p-tolyltriazenide |
| 4,4'-dimethyldiazoaminobenzene |
| 1,3-bis(tolyl)triazene |
| 1,3-Dimethylphenyltriazene |
| 1,3-Di-p-tolyltriazene |