(R-2-AMINO-1,1-DIFLUORO2-PHENYL)ETHYLPHOSPHONICACID structure
|
Common Name | (R-2-AMINO-1,1-DIFLUORO2-PHENYL)ETHYLPHOSPHONICACID | ||
|---|---|---|---|---|
| CAS Number | 176039-39-7 | Molecular Weight | 412.43600 | |
| Density | 1.284g/cm3 | Boiling Point | 634.6ºC at 760 mmHg | |
| Molecular Formula | C22H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.6ºC | |
| Symbol |
GHS05, GHS06, GHS08 |
Signal Word | Danger | |
| Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 634.6ºC at 760 mmHg |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.43600 |
| Flash Point | 337.6ºC |
| Exact Mass | 412.16300 |
| PSA | 113.96000 |
| LogP | 4.24230 |
| Vapour Pressure | 5.61E-17mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | AWCFKRJSLGKRNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Symbol |
GHS05, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H314-H317-H335-H341-H350-H370 |
| Precautionary Statements | P201-P260-P280-P301 + P310 + P330-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338-P308 + P311 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RIDADR | UN 2209 8 / PGIII |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~80%
(R-2-AMINO-1,1-... CAS#:176039-39-7 |
| Literature: Yaouancq, Loic; Rene, Loic; Tran Huu Dau, Marie-Elise; Badet, Bernard The Journal of organic chemistry, 2002 , vol. 67, # 15 p. 5408 - 5411 |
|
~%
(R-2-AMINO-1,1-... CAS#:176039-39-7 |
| Literature: The Journal of organic chemistry, , vol. 67, # 15 p. 5408 - 5411 |
|
~%
(R-2-AMINO-1,1-... CAS#:176039-39-7 |
| Literature: Synthetic Communications, , vol. 26, # 17 p. 3237 - 3239 |
|
~%
(R-2-AMINO-1,1-... CAS#:176039-39-7 |
| Literature: Tetrahedron Letters, , vol. 34, # 24 p. 3861 - 3862 |
|
~%
(R-2-AMINO-1,1-... CAS#:176039-39-7 |
| Literature: Tetrahedron Letters, , vol. 34, # 24 p. 3861 - 3862 |
|
~%
(R-2-AMINO-1,1-... CAS#:176039-39-7 |
| Literature: Synthetic Communications, , vol. 26, # 17 p. 3237 - 3239 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Boc-N inverted exclamation marka-Fmoc-diaminoacetic acid |
| N-Boc-N'-Fmoc-diaminoacetic acid |
| t-butoxycarbonylamino-9-fluorenylmethyloxycarbonylamino-acetic acid |