Z-D-Phg-OH structure
|
Common Name | Z-D-Phg-OH | ||
|---|---|---|---|---|
| CAS Number | 17609-52-8 | Molecular Weight | 285.295 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 495.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | 131 °C | |
| MSDS | Chinese USA | Flash Point | 253.4±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Z-D-Phg-OHZ-D-Phg-OH (D-Cbz phenylglycine) is a N-blocked amino acids with Kd values of 390 μM and 323 μM for tBuCQN and tBuCQD, respectively[1]. |
| Name | {[(Benzyloxy)carbonyl]amino}(phenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-D-Phg-OH (D-Cbz phenylglycine) is a N-blocked amino acids with Kd values of 390 μM and 323 μM for tBuCQN and tBuCQD, respectively[1]. |
|---|---|
| Related Catalog | |
| Target |
Kd: 390 μM (tBuCQN), 323 μM (tBuCQD)[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.3±45.0 °C at 760 mmHg |
| Melting Point | 131 °C |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.295 |
| Flash Point | 253.4±28.7 °C |
| Exact Mass | 285.100098 |
| PSA | 75.63000 |
| LogP | 3.36 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | RLDJWBVOZVJJOS-CQSZACIVSA-N |
| SMILES | O=C(NC(C(=O)O)c1ccccc1)OCc1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Compound was evaluated for the inhibition of Trypanosoma cruzi LAP (at 30 µM)
Source: ChEMBL
Target: Aminopeptidase
External Id: CHEMBL5305022
|
| Einecs 241-582-8 |
| Cbz-L-phenylglycine |
| Z-D-2-phenylglycineZ-D-Phg-OH |
| N-CBz-phenylglycine |
| MFCD00021703 |
| Z-D-phenylglycine |
| N-Carbobenzoxy-D-2-phenylglycine |
| (2R)-{[(Benzyloxy)carbonyl]amino}(phenyl)acetic acid |
| (R)-2-(((Benzyloxy)carbonyl)amino)-2-phenylacetic acid |
| (S)-Cbz-phenyl-Gly |
| Z-D-2-phenylglycine |
| Z-D-PHG-OH |
| Cbz-D-phenylglycine |
| N-Cbz-L-phenylglycine |
| (S)-Cbz-phenylglycine |
| Z-D-(PHENYL)GLY-OH |
| (2S)-N-Carboxybenzyl-2-phenylglycine |
| N-Cbz-D-phenylglycine |