4-Fluoro-2-(trifluoromethyl)benzenesulfonyl Chloride structure
|
Common Name | 4-Fluoro-2-(trifluoromethyl)benzenesulfonyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 176225-09-5 | Molecular Weight | 262.60900 | |
| Density | 1.603g/cm3 | Boiling Point | 76ºC/0.5mm | |
| Molecular Formula | C7H3ClF4O2S | Melting Point | 54-56ºC | |
| MSDS | Chinese | Flash Point | 116.3ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-Fluoro-2-(trifluoromethyl)benzene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.603g/cm3 |
|---|---|
| Boiling Point | 76ºC/0.5mm |
| Melting Point | 54-56ºC |
| Molecular Formula | C7H3ClF4O2S |
| Molecular Weight | 262.60900 |
| Flash Point | 116.3ºC |
| Exact Mass | 261.94800 |
| PSA | 42.52000 |
| LogP | 3.85280 |
| Vapour Pressure | 0.0125mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | IGMYEVQPXWKFQF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(F)cc1C(F)(F)F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | Xi,C |
| RIDADR | UN3261 |
| Packaging Group | II |
| HS Code | 2904909090 |
|
~69%
4-Fluoro-2-(tri... CAS#:176225-09-5 |
| Literature: WYETH Patent: WO2008/61016 A1, 2008 ; Location in patent: Page/Page column 84 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD01091000 |
| 4-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride |