(S)-Isopropyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate
(S)-Isopropyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate structure
|
Common Name | (S)-Isopropyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate | ||
|---|---|---|---|---|
| CAS Number | 176237-44-8 | Molecular Weight | 309.35800 | |
| Density | 1.152 g/cm3 | Boiling Point | 470.2ºC at 760 mmHg | |
| Molecular Formula | C16H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.152 g/cm3 |
|---|---|
| Boiling Point | 470.2ºC at 760 mmHg |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.35800 |
| Exact Mass | 309.15800 |
| PSA | 88.35000 |
| LogP | 2.20990 |
| Vapour Pressure | 1.21E-09mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | SPCNGEWBZXQKHY-AWEZNQCLSA-N |
| SMILES | CC(C)OC(=O)C(CCCO)NC(=O)OCc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ac-7895 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: Polar surface area (PSA) of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is 88.35000. |
| Q: What is the LogP of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: LogP of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is 2.20990. |
| Q: What is the SMILES notation of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: SMILES notation of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is CC(C)OC(=O)C(CCCO)NC(=O)OCc1ccccc1. |
| Q: What is the boiling point of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: Boiling point of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is 470.2ºC at 760 mmHg. |
| Q: What is the InChIKey of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: InChIKey of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is SPCNGEWBZXQKHY-AWEZNQCLSA-N. |
| Q: What is the English name of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: The English name of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate. |
| Q: What is the CAS number of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: CAS number of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is 176237-44-8. |
| Q: What is the molecular weight of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: Molecular weight of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is 309.35800. |
| Q: What is the molecular formula of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate? |
| A: Molecular formula of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate is C16H23NO5. |
| Q: What English synonyms does propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate have? |
| A: English synonyms of propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate: ac-7895. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |