(S)-Isopropyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate structure
|
Common Name | (S)-Isopropyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate | ||
|---|---|---|---|---|
| CAS Number | 176237-44-8 | Molecular Weight | 309.35800 | |
| Density | 1.152 g/cm3 | Boiling Point | 470.2ºC at 760 mmHg | |
| Molecular Formula | C16H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | propan-2-yl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152 g/cm3 |
|---|---|
| Boiling Point | 470.2ºC at 760 mmHg |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.35800 |
| Exact Mass | 309.15800 |
| PSA | 88.35000 |
| LogP | 2.20990 |
| Vapour Pressure | 1.21E-09mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | SPCNGEWBZXQKHY-AWEZNQCLSA-N |
| SMILES | CC(C)OC(=O)C(CCCO)NC(=O)OCc1ccccc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ac-7895 |