1,8-dihydroxyxanthen-9-one structure
|
Common Name | 1,8-dihydroxyxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 17624-02-1 | Molecular Weight | 228.20000 | |
| Density | 1.516g/cm3 | Boiling Point | 470.7ºC at 760 mmHg | |
| Molecular Formula | C13H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | 1,8-dihydroxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 470.7ºC at 760 mmHg |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20000 |
| Flash Point | 190.3ºC |
| Exact Mass | 228.04200 |
| PSA | 70.67000 |
| LogP | 2.35740 |
| Vapour Pressure | 1.76E-09mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | XWPUJQLPABYIPZ-UHFFFAOYSA-N |
| SMILES | O=c1c2c(O)cccc2oc2cccc(O)c12 |
|
~78%
1,8-dihydroxyxa... CAS#:17624-02-1 |
| Literature: Mills, Owen S.; Mooney, Nichola J.; Robinson, Peter M.; Watt, C. Ian F.; Box, Brian G. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1995 , # 4 p. 697 - 706 |
|
~19%
1,8-dihydroxyxa... CAS#:17624-02-1 |
| Literature: Liu, Yan; Zou, Lan; Ma, Lin; Chen, Wen-Hua; Wang, Bo; Xu, Zun-Le Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 16 p. 5683 - 5690 |
|
~%
1,8-dihydroxyxa... CAS#:17624-02-1 |
| Literature: Baeyer Justus Liebigs Annalen der Chemie, 1910 , vol. 372, p. 139 |
| 1,8-Dihydroxyxanthon |
| 1,8-dihydroxy-xanthen-9-one |
| Xanthenone-related compound |
| 1,8-Dihydroxy-xanthen-9-on |
| 1,8-dihydroxyxanthone |
| 1,8-dihydroxy-9H-xanthen-9-one |