1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole structure
|
Common Name | 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 17639-64-4 | Molecular Weight | 221.275 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 377.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H11NO2S | Melting Point | 98-102 °C | |
| MSDS | N/A | Flash Point | 182.0±25.9 °C | |
| Name | 1-(p-Toluenesulfonyl)pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.3±35.0 °C at 760 mmHg |
| Melting Point | 98-102 °C |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.275 |
| Flash Point | 182.0±25.9 °C |
| Exact Mass | 221.051056 |
| PSA | 47.45000 |
| LogP | 2.73 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | OXWIEWFMRVJGNY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)n2cccc2)cc1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25-S36-S26 |
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(p-Toluenesulfonyl)pyrrole |
| 1-Tosylpyrrole |
| 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole |
| 1H-Pyrrole, 1-[(4-methylphenyl)sulfonyl]- |
| 1-Tosyl-1H-pyrrole |
| 1-(4-methylphenyl)sulfonylpyrrole |
| MFCD00145014 |