2H-1,2,4-Benzothiadiazine-7-sulfonamide,6-chloro-3,4-dihydro-3-[[(2,2,2-trifluoroethyl)thio]methyl]-, 1,1-dioxide structure
|
Common Name | 2H-1,2,4-Benzothiadiazine-7-sulfonamide,6-chloro-3,4-dihydro-3-[[(2,2,2-trifluoroethyl)thio]methyl]-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 1764-85-8 | Molecular Weight | 425.85500 | |
| Density | 1.636g/cm3 | Boiling Point | 586.6ºC at 760mmHg | |
| Molecular Formula | C10H11ClF3N3O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.6ºC | |
Use of 2H-1,2,4-Benzothiadiazine-7-sulfonamide,6-chloro-3,4-dihydro-3-[[(2,2,2-trifluoroethyl)thio]methyl]-, 1,1-dioxideEpitizide, a benzothiadiazine, commonly found in combination Triamterene, is used to produce diuresis[1]. |
| Name | 6-chloro-1,1-dioxo-3-(2,2,2-trifluoroethylsulfanylmethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Epitizide, a benzothiadiazine, commonly found in combination Triamterene, is used to produce diuresis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.636g/cm3 |
|---|---|
| Boiling Point | 586.6ºC at 760mmHg |
| Molecular Formula | C10H11ClF3N3O4S3 |
| Molecular Weight | 425.85500 |
| Flash Point | 308.6ºC |
| Exact Mass | 424.95500 |
| PSA | 160.42000 |
| LogP | 4.64150 |
| Vapour Pressure | 9.64E-14mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | RINBGYCKMGDWPY-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC(CSCC(F)(F)F)NS2(=O)=O |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Epitizid |
| Epitizide |
| Epitizidum |
| P 2105 |
| EPITHIAZIDE |
| Epithiazide [USAN] |