2',3',5',6'-TETRAFLUOROACETANILIDE structure
|
Common Name | 2',3',5',6'-TETRAFLUOROACETANILIDE | ||
|---|---|---|---|---|
| CAS Number | 1766-14-9 | Molecular Weight | 207.12500 | |
| Density | 1.486g/cm3 | Boiling Point | 241.643ºC at 760 mmHg | |
| Molecular Formula | C8H5F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.942ºC | |
| Name | N-(2,3,5,6-tetrafluorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 241.643ºC at 760 mmHg |
| Molecular Formula | C8H5F4NO |
| Molecular Weight | 207.12500 |
| Flash Point | 99.942ºC |
| Exact Mass | 207.03100 |
| PSA | 29.10000 |
| LogP | 2.27440 |
| Vapour Pressure | 0.035mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | YACCDYDHWZNJOA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(F)c(F)cc(F)c1F |
| HS Code | 2924299090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetamide,N-(2,3,5,6-tetrafluorophenyl) |
| 2.3.5.6-Tetrafluor-acetanilid |
| 2',3',5',6'-tetrafluoroacetanilide |
| acet(2,3,5,6-tetrafluoroanilide) |