Acetamide,N-(2,3,4,5,6-pentafluorophenyl)- structure
|
Common Name | Acetamide,N-(2,3,4,5,6-pentafluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 653-22-5 | Molecular Weight | 225.11500 | |
| Density | 1.568g/cm3 | Boiling Point | 229.1ºC at 760mmHg | |
| Molecular Formula | C8H4F5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.3ºC | |
| Name | N-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568g/cm3 |
|---|---|
| Boiling Point | 229.1ºC at 760mmHg |
| Molecular Formula | C8H4F5NO |
| Molecular Weight | 225.11500 |
| Flash Point | 92.3ºC |
| Exact Mass | 225.02100 |
| PSA | 29.10000 |
| LogP | 2.41350 |
| Index of Refraction | 1.476 |
| InChIKey | REWJFHAZUPISFU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(F)c(F)c(F)c(F)c1F |
|
~93%
Acetamide,N-(2,... CAS#:653-22-5 |
| Literature: Prikhodko; Adonin; Parmon Russian Chemical Bulletin, 2009 , vol. 58, # 11 p. 2304 - 2310 Izv. Akad. Nauk, Ser. Khim., 2009 , # 11 p. 2234 - 2239,6 |
|
~%
Acetamide,N-(2,... CAS#:653-22-5 |
| Literature: Koppang, Rolf Journal of Fluorine Chemistry, 1980 , vol. 16, p. 479 - 482 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HMS2193P07 |
| N-acetylpentafluoroaniline |
| N-pentafluorophenylethanamide |
| 1-Acetylamino-2,3,4,5,6-pentafluorobenzen |
| pentafluorophenylacetamide |
| pentafluoroanilide of acetic acid |
| 2,3,4,5,6-pentafluoroacetanilide |