3,5-Bis(3,5-dimethoxybenzyloxy)benzyl Bromide structure
|
Common Name | 3,5-Bis(3,5-dimethoxybenzyloxy)benzyl Bromide | ||
|---|---|---|---|---|
| CAS Number | 176650-93-4 | Molecular Weight | 503.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H27BrO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-Bis(3,5-dimethoxybenzyloxy)benzyl Bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H27BrO6 |
|---|---|
| Molecular Weight | 503.38200 |
| Exact Mass | 502.09900 |
| PSA | 55.38000 |
| LogP | 5.77390 |
| Index of Refraction | 1.58 |
| InChIKey | RLACLNXCSSBIKS-UHFFFAOYSA-N |
| SMILES | COc1cc(COc2cc(CBr)cc(OCc3cc(OC)cc(OC)c3)c2)cc(OC)c1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene |
| 3,5-Bis(3,5-diMethoxybenzyloxy)benzyl BroMide |
| MFCD04038410 |