4-(methyl-phenyl-amino)naphthalene-1,2-dione structure
|
Common Name | 4-(methyl-phenyl-amino)naphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 17672-02-5 | Molecular Weight | 263.29100 | |
| Density | 1.29g/cm3 | Boiling Point | 418.3ºC at 760 mmHg | |
| Molecular Formula | C17H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | 4-(N-methylanilino)naphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 418.3ºC at 760 mmHg |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.29100 |
| Flash Point | 187.2ºC |
| Exact Mass | 263.09500 |
| PSA | 37.38000 |
| LogP | 2.92930 |
| Vapour Pressure | 3.32E-07mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | GFOFRGPKZHUQDS-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=O)C(=O)c2ccccc21)c1ccccc1 |
|
~51%
4-(methyl-pheny... CAS#:17672-02-5 |
| Literature: Yoshida, Katsuhira; Oga, Norio; Koujiri, Tetsunao; Ishiguro, Miwa; Kubo, Yuji Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , # 7 p. 1891 - 1895 |
|
~%
4-(methyl-pheny... CAS#:17672-02-5 |
| Literature: Ahn, Jin Hee; Cho, Sung Yun; Ha, Jae Du; Chu, So Young; Jung, Sun Ho; Jung, Yoon Sung; Baek, Ji Yoen; Choi, In Kyung; Shin, Eun Young; Kang, Seung Kyu; Kim, Sung Soo; Cheon, Hyae Gyeong; Yang, Sung-Don; Choi, Joong-Kwon Bioorganic and medicinal chemistry letters, 2002 , vol. 12, # 15 p. 1941 - 1946 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-(N-Methylanilino)-1,2-naphthoquinone |
| 4-[methyl(phenyl)amino]naphthalene-1,2-dione |