4,4'-(1E)-penta-1,4-diene-1,3-diyldiphenol structure
|
Common Name | 4,4'-(1E)-penta-1,4-diene-1,3-diyldiphenol | ||
|---|---|---|---|---|
| CAS Number | 17676-24-3 | Molecular Weight | 252.308 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 429.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.8±21.9 °C | |
Use of 4,4'-(1E)-penta-1,4-diene-1,3-diyldiphenol(-)-Hinokiresinol (Hinokiresinol; trans-Hinokiresinol) can be isolated from Chamaecyparis obtusa. (-)-Hinokiresinol has weak termiticidal activity but strong antifeedant and repellent activity[1]. |
| Name | hinokiresinol |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Hinokiresinol (Hinokiresinol; trans-Hinokiresinol) can be isolated from Chamaecyparis obtusa. (-)-Hinokiresinol has weak termiticidal activity but strong antifeedant and repellent activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.4±40.0 °C at 760 mmHg |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.308 |
| Flash Point | 203.8±21.9 °C |
| Exact Mass | 252.115036 |
| PSA | 40.46000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | VEAUNWQYYMXIRB-ZRFDWSJLSA-N |
| SMILES | C=CC(C=Cc1ccc(O)cc1)c1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2907299090 |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,4'-[(1E)-1,4-Pentadiene-1,3-diyl]diphenol |
| 4,4'-(3-Ethenyl-1-propene-1,3-diyl)-bisphenol |
| 4-[(1E,3S)-1-(4-Hydroxyphenyl)-1,4-pentadien-3-yl]phenol |
| Phenol, 4-[(1S,2E)-1-ethenyl-3-(4-hydroxyphenyl)-2-propen-1-yl]- |
| (-)-hinokiresinol |
| Phenol, 4,4'-(3-ethenyl-1-propene-1,3-diyl)bis-, (E)- |
| Phenol, 4,4'-[(1E)-3-ethenyl-1-propene-1,3-diyl]bis- |
| 4,4'-(1E,3S)-penta-1,4-diene-1,3-diyldiphenol |
| trans-Hinokiresinol |
| 4,4'-(1E)-penta-1,4-diene-1,3-diyldiphenol |