Ac-Phe-pNA structure
|
Common Name | Ac-Phe-pNA | ||
|---|---|---|---|---|
| CAS Number | 17682-83-6 | Molecular Weight | 327.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-acetamido-N-(4-nitrophenyl)-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17N3O4 |
|---|---|
| Molecular Weight | 327.33500 |
| Exact Mass | 327.12200 |
| PSA | 104.02000 |
| LogP | 3.26780 |
| InChIKey | TZLBBSYDVWOTKB-INIZCTEOSA-N |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~86%
Ac-Phe-pNA CAS#:17682-83-6 |
| Literature: Kasafirek, Evzen; Bartik, Michal Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 2 p. 442 - 451 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-acetylphenylalanine p-nitroanilide |
| N-Acetyl-L-phenylalanin-p-nitranilid |
| Ac-Phe-pNA |
| Acetyl-L-phenylalanine p-nitroanilide |
| N-Acetyl-L-phenylalanine p-nitroanilide |