Ac-Phe-Gly-pNA structure
|
Common Name | Ac-Phe-Gly-pNA | ||
|---|---|---|---|---|
| CAS Number | 34336-99-7 | Molecular Weight | 384.38600 | |
| Density | 1.326g/cm3 | Boiling Point | 724.7ºC at 760mmHg | |
| Molecular Formula | C19H20N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 392.1ºC | |
Use of Ac-Phe-Gly-pNAAc-Phe-Gly-pNA is the chymotrypsin specific substrate[1]. |
| Name | (2S)-2-acetamido-N-[2-(4-nitroanilino)acetyl]-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Ac-Phe-Gly-pNA is the chymotrypsin specific substrate[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 724.7ºC at 760mmHg |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.38600 |
| Flash Point | 392.1ºC |
| Exact Mass | 384.14300 |
| PSA | 133.12000 |
| LogP | 2.77490 |
| Index of Refraction | 1.62 |
| InChIKey | NCQTWSDYMRWNMC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)NCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Acetyl-L-phenylalanylglycin-p-nitroanilid |
| Glycinamide,N-acetyl-L-phenylalanyl-N-(4-nitrophenyl) |
| Nacphe-gly-4-NA |
| Ac-Phe-Gly-(p-Nitroanilid) |
| N-Acetylphenylalanylglycine 4-nitroanilide |
| Ac-Phe-Gly-pNA |