2-Nitro-9H-pyrido[2,3-b]indole structure
|
Common Name | 2-Nitro-9H-pyrido[2,3-b]indole | ||
|---|---|---|---|---|
| CAS Number | 176853-91-1 | Molecular Weight | 213.19200 | |
| Density | 1.511g/cm3 | Boiling Point | 479.8ºC at 760 mmHg | |
| Molecular Formula | C11H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244ºC | |
| Name | 2-Nitro-9H-pyrido[2,3-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 479.8ºC at 760 mmHg |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.19200 |
| Flash Point | 244ºC |
| Exact Mass | 213.05400 |
| PSA | 74.50000 |
| LogP | 3.14750 |
| Vapour Pressure | 6.67E-09mmHg at 25°C |
| Index of Refraction | 1.812 |
| InChIKey | MZRPARBJFRBBRX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(n1)[nH]c1ccccc12 |
|
~38%
2-Nitro-9H-pyri... CAS#:176853-91-1 |
| Literature: Frederiksen, Hanne; Frandsen, Henrik Pharmacology and Toxicology, 2002 , vol. 90, # 3 p. 127 - 134 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Nitro-A|AC |