5-iodo-2,4-dioxo-1H-pyrimidine-6-carboxylic acid structure
|
Common Name | 5-iodo-2,4-dioxo-1H-pyrimidine-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 17687-22-8 | Molecular Weight | 281.99300 | |
| Density | 2.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H3IN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-iodo-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.54g/cm3 |
|---|---|
| Molecular Formula | C5H3IN2O4 |
| Molecular Weight | 281.99300 |
| Exact Mass | 281.91400 |
| PSA | 103.54000 |
| LogP | 0.19060 |
| Index of Refraction | 1.742 |
| InChIKey | NWVVOUXUHGRCGE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1[nH]c(=O)[nH]c(=O)c1I |
| WGK Germany | 3 |
|---|---|
| HS Code | 2933599090 |
|
~%
5-iodo-2,4-diox... CAS#:17687-22-8 |
| Literature: Synthetic Communications, , vol. 18, # 8 p. 855 - 868 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Carboxy-2,4-dihydroxy-5-iodopyrimidine |
| 2,6-dihydroxy-5-iodopyrimidine-4-carboxylic acid |
| 5-iodo-2,6-dioxo-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid |
| 5-IODOOROTIC ACID |
| 5-Jod-2,6-dioxo-1,2,3,6-tetrahydro-pyrimidin-4-carbonsaeure |
| 5-Jod-orotsaeure |