1,2,3,4-tetrafluorofluoren-9-one structure
|
Common Name | 1,2,3,4-tetrafluorofluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 17698-86-1 | Molecular Weight | 252.16400 | |
| Density | 1.559g/cm3 | Boiling Point | 367.6ºC at 760 mmHg | |
| Molecular Formula | C13H4F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.5ºC | |
| Name | 1,2,3,4-tetrafluorofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 367.6ºC at 760 mmHg |
| Molecular Formula | C13H4F4O |
| Molecular Weight | 252.16400 |
| Flash Point | 140.5ºC |
| Exact Mass | 252.02000 |
| PSA | 17.07000 |
| LogP | 3.45440 |
| Vapour Pressure | 1.35E-05mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | QBZOIEIJWHHELD-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2-c2c(F)c(F)c(F)c(F)c21 |
|
~%
1,2,3,4-tetrafl... CAS#:17698-86-1 |
| Literature: Namkung,M.J.; Fletcher,T.L. Canadian Journal of Chemistry, 1967 , vol. 45, p. 2569 - 2575 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1,2,3,4-Tetrafluorfluorenon |
| 1,2,3,4-Tetrafluoro-fluoren-9-one |
| 1,2,3,4-tetrafluorofluorenone |
| 1,2,3,4-tetrafluoro-9H-fluoren-9-one |
| 1,2,3,4-Tetrafluor-fluoren-9-on |