9H-Purin-6-amine,8-phenyl- structure
|
Common Name | 9H-Purin-6-amine,8-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 17720-22-8 | Molecular Weight | 211.22300 | |
| Density | 1.416g/cm3 | Boiling Point | 506.5ºC at 760 mmHg | |
| Molecular Formula | C11H9N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.6ºC | |
| Name | 8-phenyl-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 506.5ºC at 760 mmHg |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.22300 |
| Flash Point | 292.6ºC |
| Exact Mass | 211.08600 |
| PSA | 80.48000 |
| LogP | 2.18330 |
| Vapour Pressure | 2.21E-10mmHg at 25°C |
| Index of Refraction | 1.764 |
| InChIKey | KFMQOHDPKOQCMU-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2nc(-c3ccccc3)[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-phenyl-9H-purin-6-amine |
| 8-phenyladenine |