Diphenylmethylfluorosilane structure
|
Common Name | Diphenylmethylfluorosilane | ||
|---|---|---|---|---|
| CAS Number | 17739-53-6 | Molecular Weight | 216.32600 | |
| Density | 1.04g/cm3 | Boiling Point | 104-106ºC (10 mmHg) | |
| Molecular Formula | C13H13FSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.9ºC | |
| Name | Diphenylmethylfluorosilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 104-106ºC (10 mmHg) |
| Molecular Formula | C13H13FSi |
| Molecular Weight | 216.32600 |
| Flash Point | 109.9ºC |
| Exact Mass | 216.07700 |
| LogP | 2.34560 |
| Vapour Pressure | 0.0225mmHg at 25°C |
| Index of Refraction | 1.547-1.55 |
| InChIKey | IKJRVUCIKVZRRR-UHFFFAOYSA-N |
| SMILES | C[Si](F)(c1ccccc1)c1ccccc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S45 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD03093773 |
| Methylfluorodiphenylsilane |
| Methyldiphenylfluorosilane |
| FLUORODIPHENYLMETHYLSILANE |
| di-phenylmethylsilyl fluoride |
| Methyldiphenylsilyl fluoride |
| Fluoromethyldiphenylsilane |
| Fluor-methyl-diphenyl-silan |
| Diphenylfluoromethylsilane |
| Diphenyl-methyl-silylfluorid |