Trichloro(trichloromethyl)silane structure
|
Common Name | Trichloro(trichloromethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 17760-13-3 | Molecular Weight | 252.814 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 205.0±30.0 °C at 760 mmHg | |
| Molecular Formula | CCl6Si | Melting Point | 112-115ºC(lit.) | |
| MSDS | N/A | Flash Point | 93.7±19.3 °C | |
| Name | trichloromethyltrichlorosilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 205.0±30.0 °C at 760 mmHg |
| Melting Point | 112-115ºC(lit.) |
| Molecular Formula | CCl6Si |
| Molecular Weight | 252.814 |
| Flash Point | 93.7±19.3 °C |
| Exact Mass | 249.790039 |
| LogP | 6.13 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | YWUUHVWMPSPGQO-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)[Si](Cl)(Cl)Cl |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 14-34 |
| Safety Phrases | 22-26-36/37/39-45 |
| RIDADR | UN 2924 |
| WGK Germany | 3 |
| Trichlormethyltrichlorsilan |
| Trichlor-trichlormethyl-silan |
| trichloro(trichloromethyl)-silan |
| (trichloromethyl)trichlorosilane |
| Silane, trichloro(trichloromethyl)- |
| IN TOLUENE |
| Trichloromethyltrichlorosilaneintoluene |
| Trichloro(trichloromethyl)silane |
| (Trichlorosilyl)trichloromethane |