Proxyfan Oxalate structure
|
Common Name | Proxyfan Oxalate | ||
|---|---|---|---|---|
| CAS Number | 177708-09-7 | Molecular Weight | 332.35100 | |
| Density | 1.115g/cm3 | Boiling Point | 414.5ºC at 760mmHg | |
| Molecular Formula | C17H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
Use of Proxyfan OxalateProxyfan Oxalate is a potent histamine H3 receptor ligand, acting as a protean agonist with activity ranges from full agonist to inverse agonist depending on system used. also displaying partial agonist effects on cAMP inhibition and MAPK activity, neutral antagonist activity on histamine release and partial inverse agonism of [3H]-arachidonic acid release. |
| Name | but-2-enedioic acid,5-(3-phenylmethoxypropyl)-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 414.5ºC at 760mmHg |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.35100 |
| Flash Point | 149.9ºC |
| Exact Mass | 332.13700 |
| PSA | 112.51000 |
| LogP | 2.27090 |
| Vapour Pressure | 1.07E-06mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | WNWALBVQAAIULR-UHFFFAOYSA-N |
| SMILES | c1ccc(COCCCc2cnc[nH]2)cc1 |
| Proxyfan oxalate |