tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate
![tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate Structure](https://image.chemsrc.com/caspic/096/177948-02-6.png)
tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate structure
|
Common Name | tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 177948-02-6 | Molecular Weight | 230.30400 | |
| Density | N/A | Boiling Point | 367.0±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 367.0±17.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.30400 |
| Exact Mass | 230.16300 |
| PSA | 74.08000 |
| LogP | 1.15880 |
| InChIKey | ZVUCOORWSKRJII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(O)CCNCC1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![1-Oxa-6-azaspiro[2.5]octane,6-(phenylmethyl) structure](https://image.chemsrc.com/caspic/042/19867-34-6.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-hydroxy-4-tert-butoxycarbonylaminomethylpiperidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: LogP of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is 1.15880. |
| Q: What is the polar surface area (PSA) of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is 74.08000. |
| Q: What is the molecular weight of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: Molecular weight of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is 230.30400. |
| Q: What English synonyms does tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate have? |
| A: English synonyms of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate: 4-hydroxy-4-tert-butoxycarbonylaminomethylpiperidine. |
| Q: What is the English name of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: The English name of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate. |
| Q: What is the boiling point of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: Boiling point of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is 367.0±17.0 °C at 760 mmHg. |
| Q: What is the CAS number of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: CAS number of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is 177948-02-6. |
| Q: What is the SMILES notation of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: SMILES notation of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is CC(C)(C)OC(=O)NCC1(O)CCNCC1. |
| Q: What is the InChIKey of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: InChIKey of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is ZVUCOORWSKRJII-UHFFFAOYSA-N. |
| Q: What is the molecular formula of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate? |
| A: Molecular formula of tert-butyl N-[(4-hydroxypiperidin-4-yl)methyl]carbamate is C11H22N2O3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |