4,6-Pyrimidinediamine,N4,N6-bis(2-furanylmethyl)-5-nitro- structure
|
Common Name | 4,6-Pyrimidinediamine,N4,N6-bis(2-furanylmethyl)-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 17801-44-4 | Molecular Weight | 315.28400 | |
| Density | 1.475g/cm3 | Boiling Point | 528ºC at 760mmHg | |
| Molecular Formula | C14H13N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.1ºC | |
| Name | 4-N,6-N-bis(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 528ºC at 760mmHg |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.28400 |
| Flash Point | 273.1ºC |
| Exact Mass | 315.09700 |
| PSA | 121.94000 |
| LogP | 3.46420 |
| Vapour Pressure | 3.09E-11mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | YAKCXRCZVYGCIP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(NCc2ccco2)ncnc1NCc1ccco1 |
|
~%
4,6-Pyrimidined... CAS#:17801-44-4 |
| Literature: Leese; Timmis Journal of the Chemical Society, 1958 , p. 4107,4108 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N4,N6-Difurfuryl-5-nitro-pyrimidin-4,6-diyldiamin |
| N4,N6-difurfuryl-5-nitro-pyrimidine-4,6-diyldiamine |