4,6-Dichloro-5-nitropyrimidine structure
|
Common Name | 4,6-Dichloro-5-nitropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 4316-93-2 | Molecular Weight | 193.976 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 325.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C4HCl2N3O2 | Melting Point | 100-103 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 150.8±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,6-Dichloro-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 325.8±37.0 °C at 760 mmHg |
| Melting Point | 100-103 °C(lit.) |
| Molecular Formula | C4HCl2N3O2 |
| Molecular Weight | 193.976 |
| Flash Point | 150.8±26.5 °C |
| Exact Mass | 192.944580 |
| PSA | 71.60000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | HCTISZQLTGAYOX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Cl |
| Storage condition | Refrigerator |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 3335 9 |
| WGK Germany | 3 |
| RTECS | UV8258000 |
| HS Code | 2933599090 |
|
~80%
4,6-Dichloro-5-... CAS#:4316-93-2 |
| Literature: Latli, Bachir; Jones, Paul-James; Krishnamurthy, Dhileepkumar; Senanayake, Chris H. Journal of Labelled Compounds and Radiopharmaceuticals, 2008 , vol. 51, # 1 p. 54 - 58 |
|
~56%
4,6-Dichloro-5-... CAS#:4316-93-2 |
| Literature: Yamazaki, Takahisa; Komatsu, Kazunori; Umemiya, Hiroki; Hashimoto, Yuichi; Shudo, Koichi; Kagechika, Hiroyuki Tetrahedron Letters, 1997 , vol. 38, # 48 p. 8363 - 8366 |
|
~%
4,6-Dichloro-5-... CAS#:4316-93-2 |
| Literature: ICI Patent: US2557721 , 1948 ; Full Text Show Details Boon et al. Journal of the Chemical Society, 1951 , p. 96,99 |
|
~%
4,6-Dichloro-5-... CAS#:4316-93-2 |
| Literature: Hull Journal of the Chemical Society, 1959 , p. 481,483 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrimidine, 4,6-dichloro-5-nitro- |
| 2,6-dichloro-5-nitropyridine |
| F1371-0158 |
| 4,6-Dichlor-5-nitro-pyrimidin |
| 5-nitro-4,6-dichloropyrimidine |
| 4,6-Dichloro-5-nitro-pyridine |
| 4,6-Dichloro-5-nitropyrimidine |
| PYRIMIDINE,4,6-DICHLORO-5-NITRO |
| MFCD00006107 |
| EINECS 224-340-6 |
| 4,6-dichloro-5-nitropirimidine |
| 4,6-dichloro-5-nitro-pyrimidine |