1-Pyrrolidinepropanoicacid, b-phenyl-, ethyl ester,hydrochloride (1:1) structure
|
Common Name | 1-Pyrrolidinepropanoicacid, b-phenyl-, ethyl ester,hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 17824-97-4 | Molecular Weight | 283.79400 | |
| Density | 1.083g/cm3 | Boiling Point | 344.6ºC at 760mmHg | |
| Molecular Formula | C15H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114ºC | |
| Name | ethyl 3-phenyl-3-pyrrolidin-1-ylpropanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 344.6ºC at 760mmHg |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.79400 |
| Flash Point | 114ºC |
| Exact Mass | 283.13400 |
| PSA | 29.54000 |
| LogP | 3.51660 |
| Vapour Pressure | 6.53E-05mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | ILNWWYMKRAUNPZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(c1ccccc1)N1CCCC1.Cl |
|
~%
1-Pyrrolidinepr... CAS#:17824-97-4 |
| Literature: Pollard; Mattson Journal of the American Chemical Society, 1956 , vol. 79, p. 4089 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Phenyl-3-pyrrolidino-propionsaeure-aethylester,Hydrochlorid |
| 3-phenyl-3-pyrrolidino-propionic acid ethyl ester,hydrochloride |