ethyl 2-(5-bromo-1h-indol-3-yl)-2-oxoacetate structure
|
Common Name | ethyl 2-(5-bromo-1h-indol-3-yl)-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 17826-11-8 | Molecular Weight | 296.11700 | |
| Density | 1.591g/cm3 | Boiling Point | 441ºC at 760mmHg | |
| Molecular Formula | C12H10BrNO3 | Melting Point | 248-249ºC | |
| MSDS | USA | Flash Point | 220.5ºC | |
| Name | ethyl 2-(5-bromo-1h-indol-3-yl)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 441ºC at 760mmHg |
| Melting Point | 248-249ºC |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.11700 |
| Flash Point | 220.5ºC |
| Exact Mass | 294.98400 |
| PSA | 59.16000 |
| LogP | 2.67620 |
| Vapour Pressure | 5.61E-08mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | BUQBKBPIDKCCOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1c[nH]c2ccc(Br)cc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-(5-bromo-indol-3-yl)glyoxylyl ethyl ester |
| (5-bromo-indol-3-yl)-oxo-acetic acid ethyl ester |
| Ethyl 2-(5-brom-1 H-indol-3-yl)-2-oxoacetate |
| ethylbromoindolyloxoacetate |
| (5-bromo-1H-indol-3-yl)-oxo-acetic acid ethyl ester |
| 5-Brom-indolyl-3-glyoxylsaeure-ethylester |