2-Fluorobiphenyl-4-boronic acid structure
|
Common Name | 2-Fluorobiphenyl-4-boronic acid | ||
|---|---|---|---|---|
| CAS Number | 178305-99-2 | Molecular Weight | 216.016 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 377.3±52.0 °C at 760 mmHg | |
| Molecular Formula | C12H10BFO2 | Melting Point | 243-248 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 182.0±30.7 °C | |
| Name | (3-fluoro-4-phenylphenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.3±52.0 °C at 760 mmHg |
| Melting Point | 243-248 °C(lit.) |
| Molecular Formula | C12H10BFO2 |
| Molecular Weight | 216.016 |
| Flash Point | 182.0±30.7 °C |
| Exact Mass | 216.075790 |
| PSA | 40.46000 |
| LogP | 3.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | BWYWXDFYJSIUBE-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(-c2ccccc2)c(F)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant;C: Corrosive; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Boronic acid, B-(2-fluoro[1,1'-biphenyl]-4-yl)- |
| 4-Borono-2-fluorobiphenyl |
| 2-Fluoro-4-biphenylboronic Acid |
| (2-Fluoro-4-biphenylyl)boronic acid |
| 2-Fluoro-4-Biphenylylboronic Acid |
| MFCD01075707 |
| 3-Fluoro-4-phenylbenzeneboronic Acid |
| (2-Fluorobiphenyl-4-yl)boronic acid |
| 2-Fluorobiphenyl-4-boronic acid |