7-(alpha-D-Glucopyranosyloxy)-4-methyl-2H-1-benzopyran-2-one structure
|
Common Name | 7-(alpha-D-Glucopyranosyloxy)-4-methyl-2H-1-benzopyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 17833-43-1 | Molecular Weight | 338.309 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 626.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H18O8 | Melting Point | 171-173ºC | |
| MSDS | Chinese USA | Flash Point | 233.9±25.0 °C | |
| Name | 4-Methylumbelliferyl α-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 626.9±55.0 °C at 760 mmHg |
| Melting Point | 171-173ºC |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.309 |
| Flash Point | 233.9±25.0 °C |
| Exact Mass | 338.100159 |
| PSA | 129.59000 |
| LogP | -0.46 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | YUDPTGPSBJVHCN-JZYAIQKZSA-N |
| SMILES | Cc1cc(=O)oc2cc(OC3OC(CO)C(O)C(O)C3O)ccc12 |
| Storage condition | 2-8°C |
| Water Solubility | Slightly soluble (6.4 g/L) (25 ºC) |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Glycosylation variants of a β-glucosidase secreted by a Taiwanese fungus, Chaetomella raphigera, exhibit variant-specific catalytic and biochemical properties.
PLoS ONE 9(9) , e106306, (2014) Cellulosic biomass is an abundant and promising energy source. To make cellulosic biofuels competitive against conventional fuels, conversion of rigid plant materials into sugars must become efficient... |
|
|
Scopolin-hydrolyzing beta-glucosidases in roots of Arabidopsis.
Plant Cell Physiol. 51(1) , 132-43, (2010) Three beta-glucosidases (At1g66270-BGLU21, At1g66280-BGLU22, and At3g09260-BGLU23) were purified from the roots of Arabidopsis and their cDNAs were expressed in insect cells. In addition, two beta-glu... |
|
|
Mechanism of the hydrolysis of 4-methylumbelliferyl-beta-D-glucoside by germinating and outgrowing spores of Bacillus species.
J. Appl. Microbiol. 96(6) , 1245-55, (2004) To determine the mechanism of the hydrolysis of 4-methylumbelliferyl-beta-D-glucopyranoside (beta-MUG) by germinating and outgrowing spores of Bacillus species.Spores of B. atrophaeus (formerly B. sub... |
| 2H-1-Benzopyran-2-one, 7-(β-D-glucopyranosyloxy)-4-methyl- |
| MFCD03791281 |
| 2H-1-Benzopyran-2-one, 7-(α-D-glucopyranosyloxy)-4-methyl- |
| EINECS 241-794-0 |
| (4-Methylumbelliferone)-β-D-glucopyranoside |
| 4-methylumbelliferyl β-D-glucoside |
| 4-Methyl-2-oxo-2H-chromen-7-yl β-D-glucopyranoside |
| 4-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| 4-Methyl-2-oxo-2H-chromen-7-yl α-D-glucopyranoside |
| 7-(alpha-D-Glucopyranosyloxy)-4-methyl-2H-1-benzopyran-2-one |