[1-(Diphenylphosphino)ethyl]ferrocene structure
|
Common Name | [1-(Diphenylphosphino)ethyl]ferrocene | ||
|---|---|---|---|---|
| CAS Number | 178388-23-3 | Molecular Weight | 398.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H23FeP | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | [1-(Diphenylphosphino)ethyl]ferrocene |
|---|
| Molecular Formula | C24H23FeP |
|---|---|
| Molecular Weight | 398.3 |
| InChIKey | WNHZFUIMWGWGNB-UHFFFAOYSA-N |
| SMILES | CC([C]1[CH][CH][CH][CH]1)P(c1ccccc1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H361d |
| Precautionary Statements | P201-P308 + P313 |
| RIDADR | NONH for all modes of transport |
|
Anionic four-electron donor-based palladacycles as catalysts for addition reactions of arylboronic acids with alpha,beta-unsaturated ketones, aldehydes, and alpha-ketoesters.
Org. Lett. 2nd ed., 9 , 343-346, (2007) Anionic four-electron donor-based palladacycle-catalyzed 1,4-additions of arylboronic acids with alpha,beta-unsaturated ketones and 1,2-additions of arylboronic acids with aldehydes and alpha-ketoeste... |