Stannane, dimethylbis(phenylmethyl)
Modify Date: 2025-08-25 17:54:47
Stannane, dimethylbis(phenylmethyl) structure
|
Common Name | Stannane, dimethylbis(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 17841-75-7 | Molecular Weight | 331.03100 | |
| Density | N/A | Boiling Point | 360.8ºC at 760mmHg | |
| Molecular Formula | C16H20Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.3ºC | |
| Name | dibenzyl(dimethyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 360.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H20Sn |
| Molecular Weight | 331.03100 |
| Flash Point | 176.3ºC |
| Exact Mass | 332.05900 |
| LogP | 4.79140 |
| Vapour Pressure | 4.49E-05mmHg at 25°C |
| InChIKey | SBPVNOJMOXZFTL-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(Cc1ccccc1)Cc1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~82%
Stannane, dimet... CAS#:17841-75-7 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.3.1, page 1 - 24 |
|
~42%
Stannane, dimet... CAS#:17841-75-7 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.3.1, page 1 - 24 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Dibenzyl-dimethyl-zinn |
| DIBENZYL-DIMETHYL-STANNANE |