Stannane,dichlorobis(phenylmethyl)- structure
|
Common Name | Stannane,dichlorobis(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 3002-01-5 | Molecular Weight | 371.86800 | |
| Density | N/A | Boiling Point | 395.4ºC at 760mmHg | |
| Molecular Formula | C14H14Cl2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193ºC | |
| Name | dibenzyl(dichloro)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 395.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H14Cl2Sn |
| Molecular Weight | 371.86800 |
| Flash Point | 193ºC |
| Exact Mass | 371.94900 |
| LogP | 5.00280 |
| InChIKey | MKANCOHERYHKAT-UHFFFAOYSA-L |
| SMILES | Cl[Sn](Cl)(Cc1ccccc1)Cc1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| diibenzyltin dichloride |
| dibenzyldichlorotin(IV) |
| dibenzyltin chloride |
| dibenzyltin(IV) dichloride |
| Dibenzyltin dichloride |
| dibenzyltin(IV) chloride |
| dibenzyldichlorostannane |
| Stannane,dichlorobis(phenylmethyl) |