[4-(Trimethylsilyl)phenyl]boronic acid structure
|
Common Name | [4-(Trimethylsilyl)phenyl]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 17865-11-1 | Molecular Weight | 194.111 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 294.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H15BO2Si | Melting Point | 173-178 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 131.8±27.9 °C | |
| Name | (4-trimethylsilylphenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 294.4±42.0 °C at 760 mmHg |
| Melting Point | 173-178 °C(lit.) |
| Molecular Formula | C9H15BO2Si |
| Molecular Weight | 194.111 |
| Flash Point | 131.8±27.9 °C |
| Exact Mass | 194.093430 |
| PSA | 40.46000 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | NRPZMSUGPMYBCQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1ccc(B(O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~82%
[4-(Trimethylsi... CAS#:17865-11-1 |
| Literature: DOW ADVANCED DISPLAY MATERIALS, LTD.; YOON, Seung Soo; KIM, Sung Min; KIM, Bong Ok; KWON, Hyuck Joo; EUM, Sung Jin; CHO, Young Jun; LEE, Hyo Jung Patent: WO2010/140801 A1, 2010 ; Location in patent: Page/Page column 18 ; |
|
~%
[4-(Trimethylsi... CAS#:17865-11-1 |
| Literature: US6034089 A1, ; US 6034089 A |
|
~35%
[4-(Trimethylsi... CAS#:17865-11-1 |
| Literature: Man, Shing Wong; Ping, Fang Xia; Xiao, Ling Zhang; Pik, Kwan Lo; Cheng, Yuen-Kit; Yeung, Kai-Tai; Guo, Xiliang; Shuang, Shaomin Journal of Organic Chemistry, 2005 , vol. 70, # 7 p. 2816 - 2819 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-trimethylsilyl-1-phenylboronic acid |
| MFCD00093348 |
| 4-(Trimethylsilyl)benzeneboronic Acid |
| p-trimethylsilylbenzeneboronic acid |
| (4-(Trimethylsilyl)phenyl)boronic acid |
| [4-(trimethylsilanyl)phenyl]boronic acid |
| 4-(Trimethylsilyl)phenylboronic Acid |
| [4-(Trimethylsilyl)phenyl]boronic acid |
| AMTSi039 |
| Boronic acid, B-[4-(trimethylsilyl)phenyl]- |
| 4-trimethylsilylphenylene-boronic acid |
| 4-TRIMETHYLSILYLBENZENEBORONIC ACID |