Benzenamine,N,N'-(1,4-phenylenedimethylidyne)bis[4-fluoro- (9CI) structure
|
Common Name | Benzenamine,N,N'-(1,4-phenylenedimethylidyne)bis[4-fluoro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 17866-84-1 | Molecular Weight | 320.33500 | |
| Density | 1.12g/cm3 | Boiling Point | 464.8ºC at 760mmHg | |
| Molecular Formula | C20H14F2N2 | Melting Point | 151-155ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 234.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(4-fluorophenyl)-1-[4-[(4-fluorophenyl)iminomethyl]phenyl]methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 464.8ºC at 760mmHg |
| Melting Point | 151-155ºC(lit.) |
| Molecular Formula | C20H14F2N2 |
| Molecular Weight | 320.33500 |
| Flash Point | 234.9ºC |
| Exact Mass | 320.11300 |
| PSA | 24.72000 |
| LogP | 5.46600 |
| Vapour Pressure | 2.26E-08mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | VBCDABROGMPOGB-UHFFFAOYSA-N |
| SMILES | Fc1ccc(N=Cc2ccc(C=Nc3ccc(F)cc3)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H413 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2921590090 |
|
~%
Benzenamine,N,N... CAS#:17866-84-1 |
| Literature: Polish Journal of Chemistry, , vol. 55, # 3 p. 565 - 572 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bis(4-fluoroanilino)terephthalaldehyde |