2-Ethoxy-4-formyl-6-nitrophenol structure
|
Common Name | 2-Ethoxy-4-formyl-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 178686-24-3 | Molecular Weight | 211.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 332.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9±27.9 °C | |
| Name | 3-ethoxy-4-hydroxy-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 332.5±42.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.171 |
| Flash Point | 154.9±27.9 °C |
| Exact Mass | 211.048065 |
| PSA | 92.35000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | MDWLNBVKBMKTKN-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C=O)cc([N+](=O)[O-])c1O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2913000090 |
|
~%
2-Ethoxy-4-form... CAS#:178686-24-3 |
| Literature: WO2006/117370 A1, ; Page/Page column 41 ; WO 2006/117370 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Benzaldehyde, 3-ethoxy-4-hydroxy-5-nitro- |
| 3-ethoxy-4-hydroxy-5-nitrobenzadehyde |
| 5-nitro-3-ethoxy-4-hydroxybenzaldehyde |
| 3-Ethoxy-4-hydroxy-5-nitrobenzaldehyde |
| 3-ethoxy-4-hydroxy-5-nitro-benzaldehyde |
| 5-ethoxy-4-hydroxy-3-nitrobenzaldehyde |
| Benzaldehyde,3-ethoxy-4-hydroxy-5-nitro |
| 2-Ethoxy-4-formyl-6-nitrophenol |