3',5-dichlorodiphenylamine-2-carboxylic acid structure
|
Common Name | 3',5-dichlorodiphenylamine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 17870-85-8 | Molecular Weight | 282.12200 | |
| Density | 1.47g/cm3 | Boiling Point | 420.2ºC at 760mmHg | |
| Molecular Formula | C13H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | 4-chloro-2-(3-chloroanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 420.2ºC at 760mmHg |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.12200 |
| Flash Point | 207.9ºC |
| Exact Mass | 281.00100 |
| PSA | 49.33000 |
| LogP | 4.50820 |
| Vapour Pressure | 8.21E-08mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | GSDQYSSLIKJJOG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)cc1Nc1cccc(Cl)c1 |
| HS Code | 2922499990 |
|---|
|
~92%
3',5-dichlorodi... CAS#:17870-85-8 |
| Literature: Gaidukevich, A. N.; Levitin, E. Ya.; Kravchenko, A. A.; Kazakov, G. P.; Mikitenko, E. E.; et al. Pharmaceutical Chemistry Journal, 1985 , vol. 19, # 3 p. 180 - 182 Khimiko-Farmatsevticheskii Zhurnal, 1985 , vol. 19, # 3 p. 165 - 168 |
|
~%
3',5-dichlorodi... CAS#:17870-85-8 |
| Literature: Spalding et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1596 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-Chlor-2-(3-chlor-anilino)-benzoesaeure |
| 4-Chlor-N-(3-chlor-phenyl)-anthranilsaeure |
| Dci-dpc |
| 3',5-dichlorodiphenylamine-2-carboxylic acid |
| 4-CHLORO-2-((3-CHLOROPHENYL)AMINO)BENZOIC ACID |
| 4-Chlor-N-(m-chlorphenyl)-anthranilsaeure |
| 4-chloro-2-(3-chloro-anilino)-benzoic acid |
| DCDPC |