2,2-bis(trimethylsilyl)acetamide structure
|
Common Name | 2,2-bis(trimethylsilyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 17879-45-7 | Molecular Weight | 203.429 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 241.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H21NOSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.8±24.6 °C | |
| Name | 2,2-bis(trimethylsilyl)acetamide |
|---|
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 241.4±30.0 °C at 760 mmHg |
| Molecular Formula | C8H21NOSi2 |
| Molecular Weight | 203.429 |
| Flash Point | 99.8±24.6 °C |
| Exact Mass | 203.116165 |
| PSA | 43.09000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.429 |
| InChIKey | NDVMCQUOSYOQMZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(C(N)=O)[Si](C)(C)C |
| HS Code | 3502900000 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |