trimethylsilyl benzoate structure
|
Common Name | trimethylsilyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 2078-12-8 | Molecular Weight | 194.30200 | |
| Density | 0.99g/cm3 | Boiling Point | 198.7ºC at 760mmHg | |
| Molecular Formula | C10H14O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 61.6ºC | |
| Name | trimethylsilyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 198.7ºC at 760mmHg |
| Molecular Formula | C10H14O2Si |
| Molecular Weight | 194.30200 |
| Flash Point | 61.6ºC |
| Exact Mass | 194.07600 |
| PSA | 26.30000 |
| LogP | 2.67830 |
| Vapour Pressure | 0.356mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | VFFKJOXNCSJSAQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=O)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silanol,trimethyl-,benzoate |
| benzoic acid trimethylsilanyl ester |
| Benzoesaeure-trimethylsilylester |
| Benzoic acid trimethylsilyl ester |
| EINECS 218-204-5 |