Chloromethylheptamethylcyclotetrasiloxane structure
|
Common Name | Chloromethylheptamethylcyclotetrasiloxane | ||
|---|---|---|---|---|
| CAS Number | 17882-66-5 | Molecular Weight | 331.06100 | |
| Density | 1.02g/cm3 | Boiling Point | 217.1ºC at 760mmHg | |
| Molecular Formula | C8H23ClO4Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 72ºC | |
| Name | 2-(chloromethyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 217.1ºC at 760mmHg |
| Molecular Formula | C8H23ClO4Si4 |
| Molecular Weight | 331.06100 |
| Flash Point | 72ºC |
| Exact Mass | 330.03600 |
| PSA | 36.92000 |
| LogP | 3.44010 |
| Index of Refraction | 1.434 |
| InChIKey | KDACIXJUXOJZLX-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(CCl)O[Si](C)(C)O1 |
| HS Code | 2903199000 |
|---|
|
~20%
Chloromethylhep... CAS#:17882-66-5 |
| Literature: Gmelin Handbook: Si: MVol.C, 99, page 271 - 274 |
|
~9%
Chloromethylhep... CAS#:17882-66-5 |
| Literature: Juengst, Clifford D.; Weber, William P.; Manuel, Georges Journal of Organometallic Chemistry, 1986 , vol. 308, p. 187 - 194 |
|
~%
Chloromethylhep... CAS#:17882-66-5 |
| Literature: Krieble; Elliott Journal of the American Chemical Society, 1946 , vol. 68, p. 2291 |
| HS Code | 2903199000 |
|---|---|
| Summary | 2903199000 other saturated chlorinated derivatives of acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| heptamethyl-chloromethyl-cyclotetrasiloxane |
| chloromethylheptamethylcycloterasiloxane |
| CHLOROMETHYL HEPTAMETHYL CYCLOTETRASILOXANE |
| Chlormethyl-heptamethyl-cyclotetrasiloxan |
| Heptamethyl-chlormethyl-cyclotetrasiloxan |