Octamethylcyclotetrasiloxane structure
|
Common Name | Octamethylcyclotetrasiloxane | ||
|---|---|---|---|---|
| CAS Number | 556-67-2 | Molecular Weight | 296.616 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 175.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H24O4Si4 | Melting Point | 17-18 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 63.2±23.0 °C | |
| Symbol |
GHS02, GHS08 |
Signal Word | Warning | |
| Name | octamethylcyclotetrasiloxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 175.0±0.0 °C at 760 mmHg |
| Melting Point | 17-18 °C(lit.) |
| Molecular Formula | C8H24O4Si4 |
| Molecular Weight | 296.616 |
| Flash Point | 63.2±23.0 °C |
| Exact Mass | 296.075165 |
| PSA | 36.92000 |
| LogP | 2.87360 |
| Vapour density | 1 (vs air) |
| Vapour Pressure | 1.6±0.3 mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | HMMGMWAXVFQUOA-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| Storage condition | 2-8°C |
| Water Solubility | INSOLUBLE |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H361-H413 |
| Precautionary Statements | P281 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R53;R62 |
| Safety Phrases | S36/37-S46-S51-S61 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 1 |
| RTECS | GZ4397000 |
| Packaging Group | III |
| Hazard Class | 3 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
|
Siloxane treatment by adsorption into porous materials.
Environ. Technol. 30(10) , 1073-83, (2009) Siloxanes are widely used in different applications: health care, dry cleaning, household products, paints and coatings, paper, personal care, for example. This explains their prevalence in the enviro... |
|
|
Allometric relationships to liver tissue concentrations of cyclic volatile methyl siloxanes in Atlantic cod
Environ. Pollut. 190 , 109-14, (2014) Spatial distribution and relationship of allometric measurements (length, weight and age) to liver concentrations of cyclic volatile methyl siloxanes (cVMS) including octamethylcyclotetrasiloxane (D4)... |
|
|
[Analysis of the volatile oils chemical constituents of roots of Actinidia deliciosa].
Zhong Yao Cai 31(5) , 677-8, (2008) To analyze the volatile oils chemical constituents of roots of Actinidia deliciosa.The volatile oils fraction of roots of Actinidia deliciosa. were extracted by water vapor distilling, and then the co... |
| EINECS 209-136-7 |
| Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
| Octamethylcyclotetrasiloxane |
| MFCD00003269 |
| 2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane |
| 2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |